About N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine
N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine (PubChem CID 86676179) has the molecular formula C20H18N2O2S
and a molecular weight of 350.44 g/mol. Its IUPAC name is N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine.
Molecular Properties
| Compound Name | N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine |
| PubChem CID | 86676179 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine |
| SMILES | CS(=O)(=O)Cc1ccc(N=C(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C20H18N2O2S/c1-25(23,24)15-19-13-12-18(14-21-19)22-20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14H,15H2,1H3 |
| InChIKey | MSUZHNPOCDJTMQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine?
The IUPAC name of N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine (CID 86676179) is N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine.
What is the SMILES notation for N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine?
The canonical SMILES for N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine is CS(=O)(=O)Cc1ccc(N=C(c2ccccc2)c2ccccc2)cn1.
What is the InChIKey of N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine?
The InChIKey is MSUZHNPOCDJTMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O2S/c1-25(23,24)15-19-13-12-18(14-21-19)22-20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14H,15H2,1H3.
What are the key properties of N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine?
N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine has a molecular weight of 350.44 g/mol, XLogP of 3.80, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(methylsulfonylmethyl)-3-pyridinyl]-1,1-diphenylmethanimine is sourced from PubChem (CID 86676179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).