C11H16O8 — CID 86676438
(3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;2-methylidenebutanedioic acid (PubChem CID 86676438) has the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. Its IUPAC name is (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;2-methylidenebutanedioic acid.
| Compound Name | (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;2-methylidenebutanedioic acid |
|---|---|
| PubChem CID | 86676438 |
| Molecular Formula | C11H16O8 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol;2-methylidenebutanedioic acid |
| SMILES | C=C(CC(=O)O)C(=O)O.O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O |
| InChI | InChI=1S/C6H10O4.C5H6O4/c7-3-1-9-6-4(8)2-10-5(3)6;1-3(5(8)9)2-4(6)7/h3-8H,1-2H2;1-2H2,(H,6,7)(H,8,9)/t3-,4+,5-,6-;/m1./s1 |
| InChIKey | ACFAEVWRLIDEOE-VFQQELCFSA-N |
| XLogP | -1.39 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|