About (E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene
(E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene (PubChem CID 86676460) has the molecular formula C13H25BrO3
and a molecular weight of 309.24 g/mol. Its IUPAC name is (E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene.
Molecular Properties
| Compound Name | (E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene |
| PubChem CID | 86676460 |
| Molecular Formula | C13H25BrO3 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene |
| SMILES | CCOC(CCOC/C(C)=C/CCBr)OCC |
| InChI | InChI=1S/C13H25BrO3/c1-4-16-13(17-5-2)8-10-15-11-12(3)7-6-9-14/h7,13H,4-6,8-11H2,1-3H3/b12-7+ |
| InChIKey | MHGFNUSYYIJOBV-KPKJPENVSA-N |
| XLogP | 3.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene?
The IUPAC name of (E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene (CID 86676460) is (E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene.
What is the SMILES notation for (E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene?
The canonical SMILES for (E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene is CCOC(CCOC/C(C)=C/CCBr)OCC.
What is the InChIKey of (E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene?
The InChIKey is MHGFNUSYYIJOBV-KPKJPENVSA-N. The full InChI is InChI=1S/C13H25BrO3/c1-4-16-13(17-5-2)8-10-15-11-12(3)7-6-9-14/h7,13H,4-6,8-11H2,1-3H3/b12-7+.
What are the key properties of (E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene?
(E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene has a molecular weight of 309.24 g/mol, XLogP of 3.52, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-bromo-1-(3,3-diethoxypropoxy)-2-methylpent-2-ene is sourced from PubChem (CID 86676460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).