About 7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride
7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride (PubChem CID 86676736) has the molecular formula C17H18ClN3O2
and a molecular weight of 331.80 g/mol. Its IUPAC name is 7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride.
Molecular Properties
| Compound Name | 7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride |
| PubChem CID | 86676736 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride |
| SMILES | CN(C)c1ccc(-c2cc(=O)c3ccc(N)c(N)c3o2)cc1.Cl |
| InChI | InChI=1S/C17H17N3O2.ClH/c1-20(2)11-5-3-10(4-6-11)15-9-14(21)12-7-8-13(18)16(19)17(12)22-15;/h3-9H,18-19H2,1-2H3;1H |
| InChIKey | GHUKUIUBVKEBLW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 85.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride?
The IUPAC name of 7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride (CID 86676736) is 7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride.
What is the SMILES notation for 7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride?
The canonical SMILES for 7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride is CN(C)c1ccc(-c2cc(=O)c3ccc(N)c(N)c3o2)cc1.Cl.
What is the InChIKey of 7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride?
The InChIKey is GHUKUIUBVKEBLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O2.ClH/c1-20(2)11-5-3-10(4-6-11)15-9-14(21)12-7-8-13(18)16(19)17(12)22-15;/h3-9H,18-19H2,1-2H3;1H.
What are the key properties of 7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride?
7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride has a molecular weight of 331.80 g/mol, XLogP of 3.11, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-diamino-2-[4-(dimethylamino)phenyl]chromen-4-one;hydrochloride is sourced from PubChem (CID 86676736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).