C31H29ClF3N3O3Si — CID 86676743
5-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide (PubChem CID 86676743) has the molecular formula C31H29ClF3N3O3Si and a molecular weight of 612.12 g/mol. Its IUPAC name is 5-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide.
| Compound Name | 5-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 86676743 |
| Molecular Formula | C31H29ClF3N3O3Si |
| Molecular Weight | 612.12 g/mol |
| Exact Mass | 611.16 |
| IUPAC Name | 5-[6-chloro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-4-yl]oxy-N-[3-(trifluoromethyl)phenyl]naphthalene-1-carboxamide |
| SMILES | C[Si](C)(C)CCOCn1ccc2c(Oc3cccc4c(C(=O)Nc5cccc(C(F)(F)F)c5)cccc34)cc(Cl)nc21 |
| InChI | InChI=1S/C31H29ClF3N3O3Si/c1-42(2,3)16-15-40-19-38-14-13-25-27(18-28(32)37-29(25)38)41-26-12-6-9-22-23(26)10-5-11-24(22)30(39)36-21-8-4-7-20(17-21)31(33,34)35/h4-14,17-18H,15-16,19H2,1-3H3,(H,36,39) |
| InChIKey | BPRNECQJNHQHJA-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.12 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|