About (3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide
(3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide (PubChem CID 86676751) has the molecular formula C6H13NO2S
and a molecular weight of 163.24 g/mol. Its IUPAC name is (3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide.
Molecular Properties
| Compound Name | (3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide |
| PubChem CID | 86676751 |
| Molecular Formula | C6H13NO2S |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | (3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide |
| SMILES | CC(C)[C@@H]1CCS(=O)(=O)N1 |
| InChI | InChI=1S/C6H13NO2S/c1-5(2)6-3-4-10(8,9)7-6/h5-7H,3-4H2,1-2H3/t6-/m0/s1 |
| InChIKey | LEDKUNONONIAQM-LURJTMIESA-N |
| XLogP | 0.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide?
The IUPAC name of (3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide (CID 86676751) is (3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide.
What is the SMILES notation for (3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide?
The canonical SMILES for (3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide is CC(C)[C@@H]1CCS(=O)(=O)N1.
What is the InChIKey of (3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide?
The InChIKey is LEDKUNONONIAQM-LURJTMIESA-N. The full InChI is InChI=1S/C6H13NO2S/c1-5(2)6-3-4-10(8,9)7-6/h5-7H,3-4H2,1-2H3/t6-/m0/s1.
What are the key properties of (3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide?
(3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide has a molecular weight of 163.24 g/mol, XLogP of 0.33, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-propan-2-yl-1,2-thiazolidine 1,1-dioxide is sourced from PubChem (CID 86676751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).