About boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol
boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol (PubChem CID 86676804) has the molecular formula C9H23BO5
and a molecular weight of 222.09 g/mol. Its IUPAC name is boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol.
Molecular Properties
| Compound Name | boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol |
| PubChem CID | 86676804 |
| Molecular Formula | C9H23BO5 |
| Molecular Weight | 222.09 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol |
| SMILES | CC(C)OC(C)(C)C(C)(C)O.OB(O)O |
| InChI | InChI=1S/C9H20O2.BH3O3/c1-7(2)11-9(5,6)8(3,4)10;2-1(3)4/h7,10H,1-6H3;2-4H |
| InChIKey | TWJNTVHJCJAGLJ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.09 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol?
The IUPAC name of boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol (CID 86676804) is boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol.
What is the SMILES notation for boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol?
The canonical SMILES for boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol is CC(C)OC(C)(C)C(C)(C)O.OB(O)O.
What is the InChIKey of boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol?
The InChIKey is TWJNTVHJCJAGLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2.BH3O3/c1-7(2)11-9(5,6)8(3,4)10;2-1(3)4/h7,10H,1-6H3;2-4H.
What are the key properties of boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol?
boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol has a molecular weight of 222.09 g/mol, XLogP of -0.09, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;2,3-dimethyl-3-propan-2-yloxybutan-2-ol is sourced from PubChem (CID 86676804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).