C31H52N2O4 — CID 86676977
tert-butyl N-[2-[2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanoylamino]ethyl]carbamate (PubChem CID 86676977) has the molecular formula C31H52N2O4 and a molecular weight of 516.77 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanoylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 86676977 |
| Molecular Formula | C31H52N2O4 |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.39 |
| IUPAC Name | tert-butyl N-[2-[2-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]butanoylamino]ethyl]carbamate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOC(CC)C(=O)NCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H52N2O4/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-27-36-28(7-2)29(34)32-25-26-33-30(35)37-31(3,4)5/h8-9,11-12,14-15,17-18,20-21,28H,6-7,10,13,16,19,22-27H2,1-5H3,(H,32,34)(H,33,35)/b9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | RMCFIVUZBILRIV-QXPWYRSVSA-N |
| XLogP | 7.34 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|