About cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate
cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate (PubChem CID 86677043) has the molecular formula C15H17F3O5S
and a molecular weight of 366.36 g/mol. Its IUPAC name is cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate |
| PubChem CID | 86677043 |
| Molecular Formula | C15H17F3O5S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC[C@@H](OS(=O)(=O)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C15H17F3O5S/c1-2-22-14(19)10-3-6-12(9-10)23-24(20,21)13-7-4-11(5-8-13)15(16,17)18/h4-5,7-8,10,12H,2-3,6,9H2,1H3/t10-,12+/m0/s1 |
| InChIKey | ROFYWIHCCTWRNG-CMPLNLGQSA-N |
| XLogP | 3.14 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate?
The IUPAC name of cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate (CID 86677043) is cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate.
What is the SMILES notation for cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate?
The canonical SMILES for cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate is CCOC(=O)[C@H]1CC[C@@H](OS(=O)(=O)c2ccc(C(F)(F)F)cc2)C1.
What is the InChIKey of cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate?
The InChIKey is ROFYWIHCCTWRNG-CMPLNLGQSA-N. The full InChI is InChI=1S/C15H17F3O5S/c1-2-22-14(19)10-3-6-12(9-10)23-24(20,21)13-7-4-11(5-8-13)15(16,17)18/h4-5,7-8,10,12H,2-3,6,9H2,1H3/t10-,12+/m0/s1.
What are the key properties of cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate?
cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate has a molecular weight of 366.36 g/mol, XLogP of 3.14, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cis-ethyl (1S,3R)-3-[4-(trifluoromethyl)phenyl]sulfonyloxycyclopentane-1-carboxylate is sourced from PubChem (CID 86677043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).