C23H26O8S — CID 86677576
[3-[[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]methyl]oxetan-3-yl]methyl methanesulfonate (PubChem CID 86677576) has the molecular formula C23H26O8S and a molecular weight of 462.52 g/mol. Its IUPAC name is [3-[[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]methyl]oxetan-3-yl]methyl methanesulfonate.
| Compound Name | [3-[[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]methyl]oxetan-3-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 86677576 |
| Molecular Formula | C23H26O8S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [3-[[2,3-dimethoxy-6-(1-oxo-2,3-dihydroinden-4-yl)phenoxy]methyl]oxetan-3-yl]methyl methanesulfonate |
| SMILES | COc1ccc(-c2cccc3c2CCC3=O)c(OCC2(COS(C)(=O)=O)COC2)c1OC |
| InChI | InChI=1S/C23H26O8S/c1-27-20-10-8-18(15-5-4-6-17-16(15)7-9-19(17)24)21(22(20)28-2)30-13-23(11-29-12-23)14-31-32(3,25)26/h4-6,8,10H,7,9,11-14H2,1-3H3 |
| InChIKey | AEIDXNWROIMOFG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|