About N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide
N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 86677608) has the molecular formula C8H15N3S
and a molecular weight of 185.30 g/mol. Its IUPAC name is N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide.
Molecular Properties
| Compound Name | N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide |
| PubChem CID | 86677608 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | CCNC(=S)N1CCC(CC)=N1 |
| InChI | InChI=1S/C8H15N3S/c1-3-7-5-6-11(10-7)8(12)9-4-2/h3-6H2,1-2H3,(H,9,12) |
| InChIKey | FXRHANGSKCSQEC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide?
The IUPAC name of N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide (CID 86677608) is N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide.
What is the SMILES notation for N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide?
The canonical SMILES for N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide is CCNC(=S)N1CCC(CC)=N1.
What is the InChIKey of N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide?
The InChIKey is FXRHANGSKCSQEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3S/c1-3-7-5-6-11(10-7)8(12)9-4-2/h3-6H2,1-2H3,(H,9,12).
What are the key properties of N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide?
N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide has a molecular weight of 185.30 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-diethyl-3,4-dihydropyrazole-2-carbothioamide is sourced from PubChem (CID 86677608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).