C20H22FN5O2Si — CID 86677908
2-(6-fluoroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbaldehyde (PubChem CID 86677908) has the molecular formula C20H22FN5O2Si and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbaldehyde.
| Compound Name | 2-(6-fluoroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbaldehyde |
|---|---|
| PubChem CID | 86677908 |
| Molecular Formula | C20H22FN5O2Si |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 2-(6-fluoroimidazo[1,5-a]pyridin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carbaldehyde |
| SMILES | C[Si](C)(C)CCOCn1cc(C=O)c2nc(-c3ncn4cc(F)ccc34)cnc21 |
| InChI | InChI=1S/C20H22FN5O2Si/c1-29(2,3)7-6-28-13-26-9-14(11-27)18-20(26)22-8-16(24-18)19-17-5-4-15(21)10-25(17)12-23-19/h4-5,8-12H,6-7,13H2,1-3H3 |
| InChIKey | PXBYPPDPTPHAAR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|