About 6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione
6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione (PubChem CID 86677910) has the molecular formula C7H5FN2S
and a molecular weight of 168.20 g/mol. Its IUPAC name is 6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione.
Molecular Properties
| Compound Name | 6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione |
| PubChem CID | 86677910 |
| Molecular Formula | C7H5FN2S |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione |
| SMILES | Fc1ccc2c[nH]c(=S)n2c1 |
| InChI | InChI=1S/C7H5FN2S/c8-5-1-2-6-3-9-7(11)10(6)4-5/h1-4H,(H,9,11) |
| InChIKey | SKRZOSWYUMOYSA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione?
The IUPAC name of 6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione (CID 86677910) is 6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione.
What is the SMILES notation for 6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione?
The canonical SMILES for 6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione is Fc1ccc2c[nH]c(=S)n2c1.
What is the InChIKey of 6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione?
The InChIKey is SKRZOSWYUMOYSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FN2S/c8-5-1-2-6-3-9-7(11)10(6)4-5/h1-4H,(H,9,11).
What are the key properties of 6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione?
6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione has a molecular weight of 168.20 g/mol, XLogP of 2.14, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2H-imidazo[1,5-a]pyridine-3-thione is sourced from PubChem (CID 86677910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).