C27H33FN8O2Si — CID 86677963
N-[(3R)-1-(cyanomethyl)pyrrolidin-3-yl]-2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 86677963) has the molecular formula C27H33FN8O2Si and a molecular weight of 548.70 g/mol. Its IUPAC name is N-[(3R)-1-(cyanomethyl)pyrrolidin-3-yl]-2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-[(3R)-1-(cyanomethyl)pyrrolidin-3-yl]-2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 86677963 |
| Molecular Formula | C27H33FN8O2Si |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | N-[(3R)-1-(cyanomethyl)pyrrolidin-3-yl]-2-(6-fluoro-1-methylindazol-3-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | Cn1nc(-c2cnc3c(n2)c(C(=O)N[C@@H]2CCN(CC#N)C2)cn3COCC[Si](C)(C)C)c2ccc(F)cc21 |
| InChI | InChI=1S/C27H33FN8O2Si/c1-34-23-13-18(28)5-6-20(23)24(33-34)22-14-30-26-25(32-22)21(16-36(26)17-38-11-12-39(2,3)4)27(37)31-19-7-9-35(15-19)10-8-29/h5-6,13-14,16,19H,7,9-12,15,17H2,1-4H3,(H,31,37)/t19-/m1/s1 |
| InChIKey | PJNLBQWRWNLHKT-LJQANCHMSA-N |
| XLogP | 3.76 |
| TPSA | 113.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|