C15H19F4NaO6S — CID 86678053
sodium 1,1,2,2-tetrafluoro-4-(3-hydroxyadamantane-1-carbonyl)oxybutane-1-sulfonate (PubChem CID 86678053) has the molecular formula C15H19F4NaO6S and a molecular weight of 426.36 g/mol. Its IUPAC name is sodium 1,1,2,2-tetrafluoro-4-(3-hydroxyadamantane-1-carbonyl)oxybutane-1-sulfonate.
| Compound Name | sodium 1,1,2,2-tetrafluoro-4-(3-hydroxyadamantane-1-carbonyl)oxybutane-1-sulfonate |
|---|---|
| PubChem CID | 86678053 |
| Molecular Formula | C15H19F4NaO6S |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | sodium 1,1,2,2-tetrafluoro-4-(3-hydroxyadamantane-1-carbonyl)oxybutane-1-sulfonate |
| SMILES | O=C(OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])C12CC3CC(CC(O)(C3)C1)C2.[Na+] |
| InChI | InChI=1S/C15H20F4O6S.Na/c16-14(17,15(18,19)26(22,23)24)1-2-25-11(20)12-4-9-3-10(5-12)7-13(21,6-9)8-12;/h9-10,21H,1-8H2,(H,22,23,24);/q;+1/p-1 |
| InChIKey | WMWQNUJSEDOIOW-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|