C39H44F4O8S2 — CID 86678056
1,1,2,2-tetrafluoro-4-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]adamantane-1-carbonyl]oxybutane-1-sulfonate;triphenylsulfanium (PubChem CID 86678056) has the molecular formula C39H44F4O8S2 and a molecular weight of 780.90 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]adamantane-1-carbonyl]oxybutane-1-sulfonate;triphenylsulfanium.
| Compound Name | 1,1,2,2-tetrafluoro-4-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]adamantane-1-carbonyl]oxybutane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 86678056 |
| Molecular Formula | C39H44F4O8S2 |
| Molecular Weight | 780.90 g/mol |
| Exact Mass | 780.24 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[3-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethoxy]adamantane-1-carbonyl]oxybutane-1-sulfonate;triphenylsulfanium |
| SMILES | CC(C)(C)OC(=O)COC12CC3CC(C1)CC(C(=O)OCCC(F)(F)C(F)(F)S(=O)(=O)[O-])(C3)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H30F4O8S.C18H15S/c1-17(2,3)33-15(26)11-32-19-9-13-6-14(10-19)8-18(7-13,12-19)16(27)31-5-4-20(22,23)21(24,25)34(28,29)30;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h13-14H,4-12H2,1-3H3,(H,28,29,30);1-15H/q;+1/p-1 |
| InChIKey | LAKCOOUUTPYZBH-UHFFFAOYSA-M |
| XLogP | 8.17 |
| TPSA | 119.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.90 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|