C26H50O2Si — CID 86678085
(11Z,14Z)-3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal (PubChem CID 86678085) has the molecular formula C26H50O2Si and a molecular weight of 422.77 g/mol. Its IUPAC name is (11Z,14Z)-3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal.
| Compound Name | (11Z,14Z)-3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal |
|---|---|
| PubChem CID | 86678085 |
| Molecular Formula | C26H50O2Si |
| Molecular Weight | 422.77 g/mol |
| Exact Mass | 422.36 |
| IUPAC Name | (11Z,14Z)-3-[tert-butyl(dimethyl)silyl]oxyicosa-11,14-dienal |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O2Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25(23-24-27)28-29(5,6)26(2,3)4/h11-12,14-15,24-25H,7-10,13,16-23H2,1-6H3/b12-11-,15-14- |
| InChIKey | WWBVCNPNOBIKOS-HDXUUTQWSA-N |
| XLogP | 8.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.77 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|