About 3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane
3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane (PubChem CID 86678262) has the molecular formula C11H22F2N3O5P
and a molecular weight of 345.28 g/mol. Its IUPAC name is 3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane.
Molecular Properties
| Compound Name | 3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane |
| PubChem CID | 86678262 |
| Molecular Formula | C11H22F2N3O5P |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane |
| SMILES | CCOP(=O)(OCC)C(F)(F)CCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C11H22F2N3O5P/c1-3-20-22(17,21-4-2)11(12,13)5-7-18-9-10-19-8-6-15-16-14/h3-10H2,1-2H3 |
| InChIKey | CGWRLIHLUMUFHP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane?
The IUPAC name of 3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane (CID 86678262) is 3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane.
What is the SMILES notation for 3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane?
The canonical SMILES for 3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane is CCOP(=O)(OCC)C(F)(F)CCOCCOCCN=[N+]=[N-].
What is the InChIKey of 3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane?
The InChIKey is CGWRLIHLUMUFHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22F2N3O5P/c1-3-20-22(17,21-4-2)11(12,13)5-7-18-9-10-19-8-6-15-16-14/h3-10H2,1-2H3.
What are the key properties of 3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane?
3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane has a molecular weight of 345.28 g/mol, XLogP of 3.58, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2-azidoethoxy)ethoxy]-1-diethoxyphosphoryl-1,1-difluoropropane is sourced from PubChem (CID 86678262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).