About 4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride
4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride (PubChem CID 86678297) has the molecular formula C8H19ClF2NO3P
and a molecular weight of 281.67 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride |
| PubChem CID | 86678297 |
| Molecular Formula | C8H19ClF2NO3P |
| Molecular Weight | 281.67 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride |
| SMILES | CCOP(=O)(OCC)C(F)(F)CCCN.Cl |
| InChI | InChI=1S/C8H18F2NO3P.ClH/c1-3-13-15(12,14-4-2)8(9,10)6-5-7-11;/h3-7,11H2,1-2H3;1H |
| InChIKey | VYSHEGSBUPFOQD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.67 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride?
The IUPAC name of 4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride (CID 86678297) is 4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride.
What is the SMILES notation for 4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride?
The canonical SMILES for 4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride is CCOP(=O)(OCC)C(F)(F)CCCN.Cl.
What is the InChIKey of 4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride?
The InChIKey is VYSHEGSBUPFOQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18F2NO3P.ClH/c1-3-13-15(12,14-4-2)8(9,10)6-5-7-11;/h3-7,11H2,1-2H3;1H.
What are the key properties of 4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride?
4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride has a molecular weight of 281.67 g/mol, XLogP of 3.01, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diethoxyphosphoryl-4,4-difluorobutan-1-amine;hydrochloride is sourced from PubChem (CID 86678297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).