C15H16N4O — CID 86678469
(1R,3R,4S)-3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentane-1-carbaldehyde (PubChem CID 86678469) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is (1R,3R,4S)-3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentane-1-carbaldehyde.
| Compound Name | (1R,3R,4S)-3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 86678469 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (1R,3R,4S)-3-methyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)cyclopentane-1-carbaldehyde |
| SMILES | C[C@@H]1C[C@@H](C=O)C[C@@H]1c1cnc2cnc3[nH]ccc3n12 |
| InChI | InChI=1S/C15H16N4O/c1-9-4-10(8-20)5-11(9)13-6-17-14-7-18-15-12(19(13)14)2-3-16-15/h2-3,6-11,16H,4-5H2,1H3/t9-,10-,11+/m1/s1 |
| InChIKey | PFVYNYQLVSRBAF-MXWKQRLJSA-N |
| XLogP | 2.54 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|