C21H20N4O3S — CID 86678472
cis-(3R,4S)-3-methyl-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-one (PubChem CID 86678472) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is cis-(3R,4S)-3-methyl-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-one.
| Compound Name | cis-(3R,4S)-3-methyl-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-one |
|---|---|
| PubChem CID | 86678472 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | cis-(3R,4S)-3-methyl-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]cyclopentan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2ncc([C@H]4CC(=O)C[C@H]4C)n23)cc1 |
| InChI | InChI=1S/C21H20N4O3S/c1-13-3-5-16(6-4-13)29(27,28)24-8-7-18-21(24)23-12-20-22-11-19(25(18)20)17-10-15(26)9-14(17)2/h3-8,11-12,14,17H,9-10H2,1-2H3/t14-,17+/m1/s1 |
| InChIKey | GMJMPFOXBQFVRJ-PBHICJAKSA-N |
| XLogP | 3.31 |
| TPSA | 86.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |