About [1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol
[1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol (PubChem CID 86678761) has the molecular formula C14H15F6NO
and a molecular weight of 327.27 g/mol. Its IUPAC name is [1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol |
| PubChem CID | 86678761 |
| Molecular Formula | C14H15F6NO |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol |
| SMILES | OCC1CCN(c2ccc(C(F)(F)F)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H15F6NO/c15-13(16,17)10-1-2-12(11(7-10)14(18,19)20)21-5-3-9(8-22)4-6-21/h1-2,7,9,22H,3-6,8H2 |
| InChIKey | QDALKMOHBSNQRN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol?
The IUPAC name of [1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol (CID 86678761) is [1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol.
What is the SMILES notation for [1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol?
The canonical SMILES for [1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol is OCC1CCN(c2ccc(C(F)(F)F)cc2C(F)(F)F)CC1.
What is the InChIKey of [1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol?
The InChIKey is QDALKMOHBSNQRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F6NO/c15-13(16,17)10-1-2-12(11(7-10)14(18,19)20)21-5-3-9(8-22)4-6-21/h1-2,7,9,22H,3-6,8H2.
What are the key properties of [1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol?
[1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol has a molecular weight of 327.27 g/mol, XLogP of 3.93, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2,4-bis(trifluoromethyl)phenyl]piperidin-4-yl]methanol is sourced from PubChem (CID 86678761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).