C21H18ClF5N6O3 — CID 86678985
ethyl 4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate (PubChem CID 86678985) has the molecular formula C21H18ClF5N6O3 and a molecular weight of 532.86 g/mol. Its IUPAC name is ethyl 4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 86678985 |
| Molecular Formula | C21H18ClF5N6O3 |
| Molecular Weight | 532.86 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | ethyl 4-amino-2-[6-chloro-1-(3,3,4,4,4-pentafluorobutyl)indazol-3-yl]-5-methyl-6-oxo-7H-pyrrolo[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1(C)C(=O)Nc2nc(-c3nn(CCC(F)(F)C(F)(F)F)c4cc(Cl)ccc34)nc(N)c21 |
| InChI | InChI=1S/C21H18ClF5N6O3/c1-3-36-18(35)19(2)12-14(28)29-16(30-15(12)31-17(19)34)13-10-5-4-9(22)8-11(10)33(32-13)7-6-20(23,24)21(25,26)27/h4-5,8H,3,6-7H2,1-2H3,(H3,28,29,30,31,34) |
| InChIKey | UPZQDWMUCQPENJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 125.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.86 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|