C13H13F5N2O3 — CID 86679024
methyl 2-oxo-2-[(4,4,5,5,5-pentafluoro-1-pyridin-2-ylpentyl)amino]acetate (PubChem CID 86679024) has the molecular formula C13H13F5N2O3 and a molecular weight of 340.25 g/mol. Its IUPAC name is methyl 2-oxo-2-[(4,4,5,5,5-pentafluoro-1-pyridin-2-ylpentyl)amino]acetate.
| Compound Name | methyl 2-oxo-2-[(4,4,5,5,5-pentafluoro-1-pyridin-2-ylpentyl)amino]acetate |
|---|---|
| PubChem CID | 86679024 |
| Molecular Formula | C13H13F5N2O3 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | methyl 2-oxo-2-[(4,4,5,5,5-pentafluoro-1-pyridin-2-ylpentyl)amino]acetate |
| SMILES | COC(=O)C(=O)NC(CCC(F)(F)C(F)(F)F)c1ccccn1 |
| InChI | InChI=1S/C13H13F5N2O3/c1-23-11(22)10(21)20-9(8-4-2-3-7-19-8)5-6-12(14,15)13(16,17)18/h2-4,7,9H,5-6H2,1H3,(H,20,21) |
| InChIKey | OCFYXCHKPYWRLZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|