C18H26BNO3 — CID 86679132
1,4,4-trimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-quinolin-2-one (PubChem CID 86679132) has the molecular formula C18H26BNO3 and a molecular weight of 315.22 g/mol. Its IUPAC name is 1,4,4-trimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-quinolin-2-one.
| Compound Name | 1,4,4-trimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-quinolin-2-one |
|---|---|
| PubChem CID | 86679132 |
| Molecular Formula | C18H26BNO3 |
| Molecular Weight | 315.22 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 1,4,4-trimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-quinolin-2-one |
| SMILES | CN1C(=O)CC(C)(C)c2cc(B3OC(C)(C)C(C)(C)O3)ccc21 |
| InChI | InChI=1S/C18H26BNO3/c1-16(2)11-15(21)20(7)14-9-8-12(10-13(14)16)19-22-17(3,4)18(5,6)23-19/h8-10H,11H2,1-7H3 |
| InChIKey | OGOTUXDVIUFAJZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|