C18H21ClN8O — CID 86679649
N-[(3R)-1-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperidin-3-yl]prop-2-enamide (PubChem CID 86679649) has the molecular formula C18H21ClN8O and a molecular weight of 400.87 g/mol. Its IUPAC name is N-[(3R)-1-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperidin-3-yl]prop-2-enamide.
| Compound Name | N-[(3R)-1-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 86679649 |
| Molecular Formula | C18H21ClN8O |
| Molecular Weight | 400.87 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-[(3R)-1-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]piperidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CCCN(c2nc(Nc3cnn(C)c3)nc3[nH]cc(Cl)c23)C1 |
| InChI | InChI=1S/C18H21ClN8O/c1-3-14(28)22-11-5-4-6-27(10-11)17-15-13(19)8-20-16(15)24-18(25-17)23-12-7-21-26(2)9-12/h3,7-9,11H,1,4-6,10H2,2H3,(H,22,28)(H2,20,23,24,25)/t11-/m1/s1 |
| InChIKey | MKUYPEHGJLQQNK-LLVKDONJSA-N |
| XLogP | 2.36 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.87 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|