C19H24BF3N2O3 — CID 86679740
1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)indazole (PubChem CID 86679740) has the molecular formula C19H24BF3N2O3 and a molecular weight of 396.22 g/mol. Its IUPAC name is 1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)indazole.
| Compound Name | 1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)indazole |
|---|---|
| PubChem CID | 86679740 |
| Molecular Formula | C19H24BF3N2O3 |
| Molecular Weight | 396.22 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-(oxan-2-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-(trifluoromethyl)indazole |
| SMILES | CC1(C)OB(c2ccc3c(c2)c(C(F)(F)F)nn3C2CCCCO2)OC1(C)C |
| InChI | InChI=1S/C19H24BF3N2O3/c1-17(2)18(3,4)28-20(27-17)12-8-9-14-13(11-12)16(19(21,22)23)24-25(14)15-7-5-6-10-26-15/h8-9,11,15H,5-7,10H2,1-4H3 |
| InChIKey | HWBHGDZMFLYRKF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.22 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|