About 5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid
5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid (PubChem CID 86679852) has the molecular formula C21H12Cl2N2O2S
and a molecular weight of 427.31 g/mol. Its IUPAC name is 5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid.
Molecular Properties
| Compound Name | 5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid |
| PubChem CID | 86679852 |
| Molecular Formula | C21H12Cl2N2O2S |
| Molecular Weight | 427.31 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | 5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid |
| SMILES | O=C(O)c1cc(-c2nc(-c3ccc(Cl)c(Cl)c3)cs2)ccc1-c1ccncc1 |
| InChI | InChI=1S/C21H12Cl2N2O2S/c22-17-4-2-13(10-18(17)23)19-11-28-20(25-19)14-1-3-15(16(9-14)21(26)27)12-5-7-24-8-6-12/h1-11H,(H,26,27) |
| InChIKey | ABFWHTKEAHAYLM-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.31 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid?
The IUPAC name of 5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid (CID 86679852) is 5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid.
What is the SMILES notation for 5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid?
The canonical SMILES for 5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid is O=C(O)c1cc(-c2nc(-c3ccc(Cl)c(Cl)c3)cs2)ccc1-c1ccncc1.
What is the InChIKey of 5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid?
The InChIKey is ABFWHTKEAHAYLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12Cl2N2O2S/c22-17-4-2-13(10-18(17)23)19-11-28-20(25-19)14-1-3-15(16(9-14)21(26)27)12-5-7-24-8-6-12/h1-11H,(H,26,27).
What are the key properties of 5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid?
5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid has a molecular weight of 427.31 g/mol, XLogP of 6.54, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(3,4-dichlorophenyl)-1,3-thiazol-2-yl]-2-pyridin-4-ylbenzoic acid is sourced from PubChem (CID 86679852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).