C23H16N4O4S2 — CID 86679910
4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-pyridin-4-ylbenzotriazole (PubChem CID 86679910) has the molecular formula C23H16N4O4S2 and a molecular weight of 476.54 g/mol. Its IUPAC name is 4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-pyridin-4-ylbenzotriazole.
| Compound Name | 4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-pyridin-4-ylbenzotriazole |
|---|---|
| PubChem CID | 86679910 |
| Molecular Formula | C23H16N4O4S2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 4,7-bis(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2-pyridin-4-ylbenzotriazole |
| SMILES | c1cc(-n2nc3c(-c4scc5c4OCCO5)ccc(-c4scc5c4OCCO5)c3n2)ccn1 |
| InChI | InChI=1S/C23H16N4O4S2/c1-2-15(23-21-17(12-33-23)29-8-10-31-21)19-18(25-27(26-19)13-3-5-24-6-4-13)14(1)22-20-16(11-32-22)28-7-9-30-20/h1-6,11-12H,7-10H2 |
| InChIKey | OQVSLOQDSDHTEY-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |