About 1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol
1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol (PubChem CID 86679986) has the molecular formula C10H15F2N5O3
and a molecular weight of 291.26 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol.
Molecular Properties
| Compound Name | 1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol |
| PubChem CID | 86679986 |
| Molecular Formula | C10H15F2N5O3 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol |
| SMILES | O=[N+]([O-])c1cnn(CC(F)F)c1N1CCNCC(O)C1 |
| InChI | InChI=1S/C10H15F2N5O3/c11-9(12)6-16-10(8(4-14-16)17(19)20)15-2-1-13-3-7(18)5-15/h4,7,9,13,18H,1-3,5-6H2 |
| InChIKey | GNGXOGUELRVZID-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol?
The IUPAC name of 1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol (CID 86679986) is 1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol.
What is the SMILES notation for 1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol?
The canonical SMILES for 1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol is O=[N+]([O-])c1cnn(CC(F)F)c1N1CCNCC(O)C1.
What is the InChIKey of 1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol?
The InChIKey is GNGXOGUELRVZID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F2N5O3/c11-9(12)6-16-10(8(4-14-16)17(19)20)15-2-1-13-3-7(18)5-15/h4,7,9,13,18H,1-3,5-6H2.
What are the key properties of 1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol?
1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol has a molecular weight of 291.26 g/mol, XLogP of -0.17, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-1,4-diazepan-6-ol is sourced from PubChem (CID 86679986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).