C15H22F3N5O4 — CID 86679993
tert-butyl 4-[4-nitro-1-(2,2,2-trifluoroethyl)pyrazol-5-yl]-1,4-diazepane-1-carboxylate (PubChem CID 86679993) has the molecular formula C15H22F3N5O4 and a molecular weight of 393.37 g/mol. Its IUPAC name is tert-butyl 4-[4-nitro-1-(2,2,2-trifluoroethyl)pyrazol-5-yl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[4-nitro-1-(2,2,2-trifluoroethyl)pyrazol-5-yl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 86679993 |
| Molecular Formula | C15H22F3N5O4 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | tert-butyl 4-[4-nitro-1-(2,2,2-trifluoroethyl)pyrazol-5-yl]-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(c2c([N+](=O)[O-])cnn2CC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H22F3N5O4/c1-14(2,3)27-13(24)21-6-4-5-20(7-8-21)12-11(23(25)26)9-19-22(12)10-15(16,17)18/h9H,4-8,10H2,1-3H3 |
| InChIKey | YPTPYKRWTVQMQF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|