About 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol
5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol (PubChem CID 86680002) has the molecular formula C11H15F2N7O3
and a molecular weight of 331.28 g/mol. Its IUPAC name is 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol.
Molecular Properties
| Compound Name | 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol |
| PubChem CID | 86680002 |
| Molecular Formula | C11H15F2N7O3 |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol |
| SMILES | [N-]=[N+]=NC1CCN(c2c([N+](=O)[O-])cnn2CC(F)F)CCC1O |
| InChI | InChI=1S/C11H15F2N7O3/c12-10(13)6-19-11(8(5-15-19)20(22)23)18-3-1-7(16-17-14)9(21)2-4-18/h5,7,9-10,21H,1-4,6H2 |
| InChIKey | HCALWUSCDFETMR-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol?
The IUPAC name of 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol (CID 86680002) is 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol.
What is the SMILES notation for 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol?
The canonical SMILES for 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol is [N-]=[N+]=NC1CCN(c2c([N+](=O)[O-])cnn2CC(F)F)CCC1O.
What is the InChIKey of 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol?
The InChIKey is HCALWUSCDFETMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2N7O3/c12-10(13)6-19-11(8(5-15-19)20(22)23)18-3-1-7(16-17-14)9(21)2-4-18/h5,7,9-10,21H,1-4,6H2.
What are the key properties of 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol?
5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol has a molecular weight of 331.28 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-azido-1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]azepan-4-ol is sourced from PubChem (CID 86680002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).