C12H16F3N5O4 — CID 86680115
2,2,2-trifluoro-N-[5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]acetamide (PubChem CID 86680115) has the molecular formula C12H16F3N5O4 and a molecular weight of 351.29 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]acetamide |
|---|---|
| PubChem CID | 86680115 |
| Molecular Formula | C12H16F3N5O4 |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 2,2,2-trifluoro-N-[5-hydroxy-1-(1-methyl-4-nitropyrazol-5-yl)azepan-4-yl]acetamide |
| SMILES | Cn1ncc([N+](=O)[O-])c1N1CCC(O)C(NC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H16F3N5O4/c1-18-10(8(6-16-18)20(23)24)19-4-2-7(9(21)3-5-19)17-11(22)12(13,14)15/h6-7,9,21H,2-5H2,1H3,(H,17,22) |
| InChIKey | WPTVFTBQCFFTOR-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 113.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|