About [5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate
[5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate (PubChem CID 86680782) has the molecular formula C10H9F3N2O4S2
and a molecular weight of 342.32 g/mol. Its IUPAC name is [5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate |
| PubChem CID | 86680782 |
| Molecular Formula | C10H9F3N2O4S2 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | [5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate |
| SMILES | CCc1sc(-c2cc(C)on2)nc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H9F3N2O4S2/c1-3-7-8(19-21(16,17)10(11,12)13)14-9(20-7)6-4-5(2)18-15-6/h4H,3H2,1-2H3 |
| InChIKey | IPFQMUANWVUAHI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate?
The IUPAC name of [5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate (CID 86680782) is [5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate.
What is the SMILES notation for [5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate?
The canonical SMILES for [5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate is CCc1sc(-c2cc(C)on2)nc1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate?
The InChIKey is IPFQMUANWVUAHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3N2O4S2/c1-3-7-8(19-21(16,17)10(11,12)13)14-9(20-7)6-4-5(2)18-15-6/h4H,3H2,1-2H3.
What are the key properties of [5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate?
[5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate has a molecular weight of 342.32 g/mol, XLogP of 2.90, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-ethyl-2-(5-methyl-1,2-oxazol-3-yl)-1,3-thiazol-4-yl] trifluoromethanesulfonate is sourced from PubChem (CID 86680782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).