C20H24F3N9O — CID 86680936
4-N-[(4-aminophenyl)methyl]-2-N-[6-(3-aminopropylamino)-3-pyridinyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine (PubChem CID 86680936) has the molecular formula C20H24F3N9O and a molecular weight of 463.47 g/mol. Its IUPAC name is 4-N-[(4-aminophenyl)methyl]-2-N-[6-(3-aminopropylamino)-3-pyridinyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[(4-aminophenyl)methyl]-2-N-[6-(3-aminopropylamino)-3-pyridinyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 86680936 |
| Molecular Formula | C20H24F3N9O |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 4-N-[(4-aminophenyl)methyl]-2-N-[6-(3-aminopropylamino)-3-pyridinyl]-6-(2,2,2-trifluoroethoxy)-1,3,5-triazine-2,4-diamine |
| SMILES | NCCCNc1ccc(Nc2nc(NCc3ccc(N)cc3)nc(OCC(F)(F)F)n2)cn1 |
| InChI | InChI=1S/C20H24F3N9O/c21-20(22,23)12-33-19-31-17(28-10-13-2-4-14(25)5-3-13)30-18(32-19)29-15-6-7-16(27-11-15)26-9-1-8-24/h2-7,11H,1,8-10,12,24-25H2,(H,26,27)(H2,28,29,30,31,32) |
| InChIKey | AGJOTCDWUGQFON-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 148.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|