About 6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole
6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole (PubChem CID 86681119) has the molecular formula C15H12N4S2
and a molecular weight of 312.42 g/mol. Its IUPAC name is 6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole |
| PubChem CID | 86681119 |
| Molecular Formula | C15H12N4S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole |
| SMILES | CSc1nc2ccc(Cc3cnc4cccnn34)cc2s1 |
| InChI | InChI=1S/C15H12N4S2/c1-20-15-18-12-5-4-10(8-13(12)21-15)7-11-9-16-14-3-2-6-17-19(11)14/h2-6,8-9H,7H2,1H3 |
| InChIKey | XQYPDJUFJDSCLW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole?
The IUPAC name of 6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole (CID 86681119) is 6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole.
What is the SMILES notation for 6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole?
The canonical SMILES for 6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole is CSc1nc2ccc(Cc3cnc4cccnn34)cc2s1.
What is the InChIKey of 6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole?
The InChIKey is XQYPDJUFJDSCLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4S2/c1-20-15-18-12-5-4-10(8-13(12)21-15)7-11-9-16-14-3-2-6-17-19(11)14/h2-6,8-9H,7H2,1H3.
What are the key properties of 6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole?
6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole has a molecular weight of 312.42 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(imidazo[1,2-b]pyridazin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole is sourced from PubChem (CID 86681119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).