About 4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole
4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole (PubChem CID 86681171) has the molecular formula C15H11BrN4S2
and a molecular weight of 391.32 g/mol. Its IUPAC name is 4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole |
| PubChem CID | 86681171 |
| Molecular Formula | C15H11BrN4S2 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 389.96 |
| IUPAC Name | 4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole |
| SMILES | CSc1nc2c(Br)cc(Cn3cnc4cccnc43)cc2s1 |
| InChI | InChI=1S/C15H11BrN4S2/c1-21-15-19-13-10(16)5-9(6-12(13)22-15)7-20-8-18-11-3-2-4-17-14(11)20/h2-6,8H,7H2,1H3 |
| InChIKey | JPDPZPBMHVQZCH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole?
The IUPAC name of 4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole (CID 86681171) is 4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole.
What is the SMILES notation for 4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole?
The canonical SMILES for 4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole is CSc1nc2c(Br)cc(Cn3cnc4cccnc43)cc2s1.
What is the InChIKey of 4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole?
The InChIKey is JPDPZPBMHVQZCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrN4S2/c1-21-15-19-13-10(16)5-9(6-12(13)22-15)7-20-8-18-11-3-2-4-17-14(11)20/h2-6,8H,7H2,1H3.
What are the key properties of 4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole?
4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole has a molecular weight of 391.32 g/mol, XLogP of 4.57, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-(imidazo[4,5-b]pyridin-3-ylmethyl)-2-methylsulfanyl-1,3-benzothiazole is sourced from PubChem (CID 86681171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).