C17H12Cl3F3O5 — CID 86681292
methyl 3-methyl-5-[4,4,4-trifluoro-3-hydroxy-3-(3,4,5-trichlorophenyl)butanoyl]furan-2-carboxylate (PubChem CID 86681292) has the molecular formula C17H12Cl3F3O5 and a molecular weight of 459.63 g/mol. Its IUPAC name is methyl 3-methyl-5-[4,4,4-trifluoro-3-hydroxy-3-(3,4,5-trichlorophenyl)butanoyl]furan-2-carboxylate.
| Compound Name | methyl 3-methyl-5-[4,4,4-trifluoro-3-hydroxy-3-(3,4,5-trichlorophenyl)butanoyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 86681292 |
| Molecular Formula | C17H12Cl3F3O5 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | methyl 3-methyl-5-[4,4,4-trifluoro-3-hydroxy-3-(3,4,5-trichlorophenyl)butanoyl]furan-2-carboxylate |
| SMILES | COC(=O)c1oc(C(=O)CC(O)(c2cc(Cl)c(Cl)c(Cl)c2)C(F)(F)F)cc1C |
| InChI | InChI=1S/C17H12Cl3F3O5/c1-7-3-12(28-14(7)15(25)27-2)11(24)6-16(26,17(21,22)23)8-4-9(18)13(20)10(19)5-8/h3-5,26H,6H2,1-2H3 |
| InChIKey | LYHDKSCWZOHWSB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|