About 2-(3,3-dimethylcyclohexylidene)-1,3-dithiane
2-(3,3-dimethylcyclohexylidene)-1,3-dithiane (PubChem CID 86681317) has the molecular formula C12H20S2
and a molecular weight of 228.43 g/mol. Its IUPAC name is 2-(3,3-dimethylcyclohexylidene)-1,3-dithiane.
Molecular Properties
| Compound Name | 2-(3,3-dimethylcyclohexylidene)-1,3-dithiane |
| PubChem CID | 86681317 |
| Molecular Formula | C12H20S2 |
| Molecular Weight | 228.43 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 2-(3,3-dimethylcyclohexylidene)-1,3-dithiane |
| SMILES | CC1(C)CCCC(=C2SCCCS2)C1 |
| InChI | InChI=1S/C12H20S2/c1-12(2)6-3-5-10(9-12)11-13-7-4-8-14-11/h3-9H2,1-2H3 |
| InChIKey | BNTDTDLFPUFWDP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,3-dimethylcyclohexylidene)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethylcyclohexylidene)-1,3-dithiane?
The IUPAC name of 2-(3,3-dimethylcyclohexylidene)-1,3-dithiane (CID 86681317) is 2-(3,3-dimethylcyclohexylidene)-1,3-dithiane.
What is the SMILES notation for 2-(3,3-dimethylcyclohexylidene)-1,3-dithiane?
The canonical SMILES for 2-(3,3-dimethylcyclohexylidene)-1,3-dithiane is CC1(C)CCCC(=C2SCCCS2)C1.
What is the InChIKey of 2-(3,3-dimethylcyclohexylidene)-1,3-dithiane?
The InChIKey is BNTDTDLFPUFWDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20S2/c1-12(2)6-3-5-10(9-12)11-13-7-4-8-14-11/h3-9H2,1-2H3.
What are the key properties of 2-(3,3-dimethylcyclohexylidene)-1,3-dithiane?
2-(3,3-dimethylcyclohexylidene)-1,3-dithiane has a molecular weight of 228.43 g/mol, XLogP of 4.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethylcyclohexylidene)-1,3-dithiane is sourced from PubChem (CID 86681317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).