C21H24BrF2N3O2 — CID 86681336
tert-butyl N-[(1S,2S)-1-(3-bromopyrazin-2-yl)-2-(2,3-difluorophenyl)hex-5-enyl]carbamate (PubChem CID 86681336) has the molecular formula C21H24BrF2N3O2 and a molecular weight of 468.34 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S)-1-(3-bromopyrazin-2-yl)-2-(2,3-difluorophenyl)hex-5-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S)-1-(3-bromopyrazin-2-yl)-2-(2,3-difluorophenyl)hex-5-enyl]carbamate |
|---|---|
| PubChem CID | 86681336 |
| Molecular Formula | C21H24BrF2N3O2 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | tert-butyl N-[(1S,2S)-1-(3-bromopyrazin-2-yl)-2-(2,3-difluorophenyl)hex-5-enyl]carbamate |
| SMILES | C=CCC[C@@H](c1cccc(F)c1F)[C@H](NC(=O)OC(C)(C)C)c1nccnc1Br |
| InChI | InChI=1S/C21H24BrF2N3O2/c1-5-6-8-14(13-9-7-10-15(23)16(13)24)17(18-19(22)26-12-11-25-18)27-20(28)29-21(2,3)4/h5,7,9-12,14,17H,1,6,8H2,2-4H3,(H,27,28)/t14-,17-/m0/s1 |
| InChIKey | RPJFUCNCNXDPKX-YOEHRIQHSA-N |
| XLogP | 5.83 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|