C16H16N6S — CID 866817
4-(2,5-dimethylpyrazol-3-yl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 866817) has the molecular formula C16H16N6S and a molecular weight of 324.41 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrazol-3-yl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 4-(2,5-dimethylpyrazol-3-yl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 866817 |
| Molecular Formula | C16H16N6S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 4-(2,5-dimethylpyrazol-3-yl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | Cc1cc(-c2nc3c4c5c(sc4ncn3n2)CCCC5)n(C)n1 |
| InChI | InChI=1S/C16H16N6S/c1-9-7-11(21(2)19-9)14-18-15-13-10-5-3-4-6-12(10)23-16(13)17-8-22(15)20-14/h7-8H,3-6H2,1-2H3 |
| InChIKey | AOAAQIPOQIAMQM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |