C24H23FN2O3 — CID 86681822
N-[(4-fluorophenyl)methyl]-N-(oxan-2-yloxy)-4-phenylpyridine-2-carboxamide (PubChem CID 86681822) has the molecular formula C24H23FN2O3 and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-(oxan-2-yloxy)-4-phenylpyridine-2-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-(oxan-2-yloxy)-4-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 86681822 |
| Molecular Formula | C24H23FN2O3 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-(oxan-2-yloxy)-4-phenylpyridine-2-carboxamide |
| SMILES | O=C(c1cc(-c2ccccc2)ccn1)N(Cc1ccc(F)cc1)OC1CCCCO1 |
| InChI | InChI=1S/C24H23FN2O3/c25-21-11-9-18(10-12-21)17-27(30-23-8-4-5-15-29-23)24(28)22-16-20(13-14-26-22)19-6-2-1-3-7-19/h1-3,6-7,9-14,16,23H,4-5,8,15,17H2 |
| InChIKey | NBMFBUAWAFTRRQ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|