C16H26BN3O4 — CID 86682142
tert-butyl N-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]methyl]carbamate (PubChem CID 86682142) has the molecular formula C16H26BN3O4 and a molecular weight of 335.21 g/mol. Its IUPAC name is tert-butyl N-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 86682142 |
| Molecular Formula | C16H26BN3O4 |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | tert-butyl N-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C16H26BN3O4/c1-14(2,3)22-13(21)20-10-12-18-8-11(9-19-12)17-23-15(4,5)16(6,7)24-17/h8-9H,10H2,1-7H3,(H,20,21) |
| InChIKey | KVKZDKWDTAMTQF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|