C41H50Br2N2SSi2 — CID 86682212
2-[9,9-bis(6-bromohexyl)-8-[7-(2-trimethylsilylethynyl)-1,2,3-benzothiadiazol-4-yl]fluoren-2-yl]ethynyl-trimethylsilane (PubChem CID 86682212) has the molecular formula C41H50Br2N2SSi2 and a molecular weight of 818.91 g/mol. Its IUPAC name is 2-[9,9-bis(6-bromohexyl)-8-[7-(2-trimethylsilylethynyl)-1,2,3-benzothiadiazol-4-yl]fluoren-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[9,9-bis(6-bromohexyl)-8-[7-(2-trimethylsilylethynyl)-1,2,3-benzothiadiazol-4-yl]fluoren-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 86682212 |
| Molecular Formula | C41H50Br2N2SSi2 |
| Molecular Weight | 818.91 g/mol |
| Exact Mass | 816.16 |
| IUPAC Name | 2-[9,9-bis(6-bromohexyl)-8-[7-(2-trimethylsilylethynyl)-1,2,3-benzothiadiazol-4-yl]fluoren-2-yl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1ccc2c(c1)C(CCCCCCBr)(CCCCCCBr)c1c-2cccc1-c1ccc(C#C[Si](C)(C)C)c2snnc12 |
| InChI | InChI=1S/C41H50Br2N2SSi2/c1-47(2,3)28-22-31-18-20-33-34-16-15-17-35(36-21-19-32(23-29-48(4,5)6)40-39(36)44-45-46-40)38(34)41(37(33)30-31,24-11-7-9-13-26-42)25-12-8-10-14-27-43/h15-21,30H,7-14,24-27H2,1-6H3 |
| InChIKey | SGIMEDVXVUKZMP-UHFFFAOYSA-N |
| XLogP | 12.77 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.91 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|