C16H14ClF3N4OS — CID 86682244
N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluoro-3-methylsulfanyl-N-prop-2-ynylbutanamide (PubChem CID 86682244) has the molecular formula C16H14ClF3N4OS and a molecular weight of 402.83 g/mol. Its IUPAC name is N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluoro-3-methylsulfanyl-N-prop-2-ynylbutanamide.
| Compound Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluoro-3-methylsulfanyl-N-prop-2-ynylbutanamide |
|---|---|
| PubChem CID | 86682244 |
| Molecular Formula | C16H14ClF3N4OS |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | N-(3-chloro-1-pyridin-3-ylpyrazol-4-yl)-4,4,4-trifluoro-3-methylsulfanyl-N-prop-2-ynylbutanamide |
| SMILES | C#CCN(C(=O)CC(SC)C(F)(F)F)c1cn(-c2cccnc2)nc1Cl |
| InChI | InChI=1S/C16H14ClF3N4OS/c1-3-7-23(14(25)8-13(26-2)16(18,19)20)12-10-24(22-15(12)17)11-5-4-6-21-9-11/h1,4-6,9-10,13H,7-8H2,2H3 |
| InChIKey | XNVGXGZOSDGDPG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|