C20H29N3O7 — CID 86682327
methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(cyclopropylmethoxy)pyrazine-2-carboxylate (PubChem CID 86682327) has the molecular formula C20H29N3O7 and a molecular weight of 423.47 g/mol. Its IUPAC name is methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(cyclopropylmethoxy)pyrazine-2-carboxylate.
| Compound Name | methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(cyclopropylmethoxy)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 86682327 |
| Molecular Formula | C20H29N3O7 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | methyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(cyclopropylmethoxy)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c(OCC2CC2)n1 |
| InChI | InChI=1S/C20H29N3O7/c1-19(2,3)29-17(25)23(18(26)30-20(4,5)6)14-15(28-11-12-8-9-12)22-13(10-21-14)16(24)27-7/h10,12H,8-9,11H2,1-7H3 |
| InChIKey | MNECNMTWNKNBEY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 117.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|