C32H49N3O2SSn — CID 86682383
tributyl-[1-(4-methylphenyl)sulfonyl-6-(4-methylpiperazin-1-yl)indol-2-yl]stannane (PubChem CID 86682383) has the molecular formula C32H49N3O2SSn and a molecular weight of 658.54 g/mol. Its IUPAC name is tributyl-[1-(4-methylphenyl)sulfonyl-6-(4-methylpiperazin-1-yl)indol-2-yl]stannane.
| Compound Name | tributyl-[1-(4-methylphenyl)sulfonyl-6-(4-methylpiperazin-1-yl)indol-2-yl]stannane |
|---|---|
| PubChem CID | 86682383 |
| Molecular Formula | C32H49N3O2SSn |
| Molecular Weight | 658.54 g/mol |
| Exact Mass | 659.26 |
| IUPAC Name | tributyl-[1-(4-methylphenyl)sulfonyl-6-(4-methylpiperazin-1-yl)indol-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc2ccc(N3CCN(C)CC3)cc2n1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H22N3O2S.3C4H9.Sn/c1-16-3-7-19(8-4-16)26(24,25)23-10-9-17-5-6-18(15-20(17)23)22-13-11-21(2)12-14-22;3*1-3-4-2;/h3-9,15H,11-14H2,1-2H3;3*1,3-4H2,2H3; |
| InChIKey | USJJPWHOPFDDII-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.54 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |