About 4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile
4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile (PubChem CID 86682557) has the molecular formula C15H7ClF5NO
and a molecular weight of 347.67 g/mol. Its IUPAC name is 4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile.
Molecular Properties
| Compound Name | 4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile |
| PubChem CID | 86682557 |
| Molecular Formula | C15H7ClF5NO |
| Molecular Weight | 347.67 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(OCc2ccc(Cl)c(C(F)(F)F)c2)cc1F |
| InChI | InChI=1S/C15H7ClF5NO/c16-11-2-1-8(3-10(11)15(19,20)21)7-23-14-5-12(17)9(6-22)4-13(14)18/h1-5H,7H2 |
| InChIKey | RHPRYPCKQNPAOP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile?
The IUPAC name of 4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile (CID 86682557) is 4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile.
What is the SMILES notation for 4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile?
The canonical SMILES for 4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile is N#Cc1cc(F)c(OCc2ccc(Cl)c(C(F)(F)F)c2)cc1F.
What is the InChIKey of 4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile?
The InChIKey is RHPRYPCKQNPAOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H7ClF5NO/c16-11-2-1-8(3-10(11)15(19,20)21)7-23-14-5-12(17)9(6-22)4-13(14)18/h1-5H,7H2.
What are the key properties of 4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile?
4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile has a molecular weight of 347.67 g/mol, XLogP of 5.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]-2,5-difluorobenzonitrile is sourced from PubChem (CID 86682557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).