About 3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane
3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane (PubChem CID 86682661) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is 3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane |
| PubChem CID | 86682661 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane |
| SMILES | COCC1(C2CCCCC2)COC12CCCCO2 |
| InChI | InChI=1S/C15H26O3/c1-16-11-14(13-7-3-2-4-8-13)12-18-15(14)9-5-6-10-17-15/h13H,2-12H2,1H3 |
| InChIKey | ATVNPHHRTWGPBD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane?
The IUPAC name of 3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane (CID 86682661) is 3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane.
What is the SMILES notation for 3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane?
The canonical SMILES for 3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane is COCC1(C2CCCCC2)COC12CCCCO2.
What is the InChIKey of 3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane?
The InChIKey is ATVNPHHRTWGPBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O3/c1-16-11-14(13-7-3-2-4-8-13)12-18-15(14)9-5-6-10-17-15/h13H,2-12H2,1H3.
What are the key properties of 3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane?
3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane has a molecular weight of 254.37 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-3-(methoxymethyl)-1,9-dioxaspiro[3.5]nonane is sourced from PubChem (CID 86682661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).