C36H33F5N8 — CID 86683333
5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-3-[[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]methyl]triazolo[4,5-d]pyrimidine (PubChem CID 86683333) has the molecular formula C36H33F5N8 and a molecular weight of 672.71 g/mol. Its IUPAC name is 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-3-[[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]methyl]triazolo[4,5-d]pyrimidine.
| Compound Name | 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-3-[[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]methyl]triazolo[4,5-d]pyrimidine |
|---|---|
| PubChem CID | 86683333 |
| Molecular Formula | C36H33F5N8 |
| Molecular Weight | 672.71 g/mol |
| Exact Mass | 672.27 |
| IUPAC Name | 5-tert-butyl-7-(3,3-difluoropyrrolidin-1-yl)-3-[[3-(trifluoromethyl)-1-tritylpyrazol-4-yl]methyl]triazolo[4,5-d]pyrimidine |
| SMILES | CC(C)(C)c1nc(N2CCC(F)(F)C2)c2nnn(Cc3cn(C(c4ccccc4)(c4ccccc4)c4ccccc4)nc3C(F)(F)F)c2n1 |
| InChI | InChI=1S/C36H33F5N8/c1-33(2,3)32-42-30(47-20-19-34(37,38)23-47)28-31(43-32)48(46-44-28)21-24-22-49(45-29(24)36(39,40)41)35(25-13-7-4-8-14-25,26-15-9-5-10-16-26)27-17-11-6-12-18-27/h4-18,22H,19-21,23H2,1-3H3 |
| InChIKey | QVXWJUSIERMMTD-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.71 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|